* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0478 |
| EnglishSynonyms: | RARECHEM AL BT 0478 |
| pro_mdlNumber: | MFCD06212133 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | c1cc(cc(c1)Oc2ccc(cc2[N+](=O)[O-])C(CCO)N)C(F)(F)F.Cl |
| InChi: | InChI=1S/C16H15F3N2O4.ClH/c17-16(18,19)11-2-1-3-12(9-11)25-15-5-4-10(13(20)6-7-22)8-14(15)21(23)24;/h1-5,8-9,13,22H,6-7,20H2;1H |
| InChiKey: | InChIKey=HBLVKVVDXHDDQR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.