* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0487 |
| EnglishSynonyms: | RARECHEM AL BT 0487 |
| pro_mdlNumber: | MFCD06212142 |
| pro_acceptors: | 8 |
| pro_donors: | 2 |
| pro_smile: | COc1cc(ccc1O/C=C/c2ccc(o2)[N+](=O)[O-])C(CCO)N.Cl |
| InChi: | InChI=1S/C16H18N2O6.ClH/c1-22-15-10-11(13(17)6-8-19)2-4-14(15)23-9-7-12-3-5-16(24-12)18(20)21;/h2-5,7,9-10,13,19H,6,8,17H2,1H3;1H/b9-7+; |
| InChiKey: | InChIKey=FVEKBGPXWURTJU-BXTVWIJMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.