* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0489 |
| EnglishSynonyms: | RARECHEM AL BT 0489 |
| pro_mdlNumber: | MFCD06212144 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | COc1ccc2c(c1)CCC(=C2Cl)C(CCO)N.Cl |
| InChi: | InChI=1S/C14H18ClNO2.ClH/c1-18-10-3-5-11-9(8-10)2-4-12(14(11)15)13(16)6-7-17;/h3,5,8,13,17H,2,4,6-7,16H2,1H3;1H |
| InChiKey: | InChIKey=GPRFBGIJSQNUCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.