* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0495 |
| EnglishSynonyms: | RARECHEM AL BT 0495 |
| pro_mdlNumber: | MFCD06212150 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | c1cc(oc1c2cc(cc(c2)C(F)(F)F)C(F)(F)F)C(CCO)N.Cl |
| InChi: | InChI=1S/C15H13F6NO2.ClH/c16-14(17,18)9-5-8(6-10(7-9)15(19,20)21)12-1-2-13(24-12)11(22)3-4-23;/h1-2,5-7,11,23H,3-4,22H2;1H |
| InChiKey: | InChIKey=LSTCBWRCDGRBCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.