* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0539 |
| EnglishSynonyms: | RARECHEM AL BT 0539 |
| pro_mdlNumber: | MFCD06212193 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1cc(ccc1C(=O)c2cc3cc(ccc3o2)C(CCO)N)Br.Cl |
| InChi: | InChI=1S/C18H16BrNO3.ClH/c19-14-4-1-11(2-5-14)18(22)17-10-13-9-12(15(20)7-8-21)3-6-16(13)23-17;/h1-6,9-10,15,21H,7-8,20H2;1H |
| InChiKey: | InChIKey=CBXJSSKVZSHWOK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.