* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0587 |
| EnglishSynonyms: | RARECHEM AL BT 0587 |
| pro_mdlNumber: | MFCD06212240 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)c1cc(n(n1)c2ccc(cc2)C(CCO)N)C(C)(C)C.Cl |
| InChi: | InChI=1S/C20H31N3O.ClH/c1-19(2,3)17-13-18(20(4,5)6)23(22-17)15-9-7-14(8-10-15)16(21)11-12-24;/h7-10,13,16,24H,11-12,21H2,1-6H3;1H |
| InChiKey: | InChIKey=OKCYVVSJMOALIX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.