* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 0532 |
| EnglishSynonyms: | RARECHEM AL BW 0532 |
| pro_mdlNumber: | MFCD06212699 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | Cc1cccc(c1Oc2ccc(c(c2)CN)CN)C |
| InChi: | InChI=1S/C16H20N2O/c1-11-4-3-5-12(2)16(11)19-15-7-6-13(9-17)14(8-15)10-18/h3-8H,9-10,17-18H2,1-2H3 |
| InChiKey: | InChIKey=SBDKRNWMHIRTKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.