* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BW 0589 |
EnglishSynonyms: | RARECHEM AL BW 0589 |
pro_mdlNumber: | MFCD06212734 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | c1cc(c(c(c1)Cl)CN)Oc2ccc(cc2)S(=O)(=O)Cl |
InChi: | InChI=1S/C13H11Cl2NO3S/c14-12-2-1-3-13(11(12)8-16)19-9-4-6-10(7-5-9)20(15,17)18/h1-7H,8,16H2 |
InChiKey: | InChIKey=BAXBKVYWZUVNPJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.