* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 0729 |
| EnglishSynonyms: | RARECHEM AL BW 0729 |
| pro_mdlNumber: | MFCD06212827 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | c1cc(ccc1C=O)OCc2ccsc2CN |
| InChi: | InChI=1S/C13H13NO2S/c14-7-13-11(5-6-17-13)9-16-12-3-1-10(8-15)2-4-12/h1-6,8H,7,9,14H2 |
| InChiKey: | InChIKey=HSKNUDYIGQGEEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.