* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 0763 |
| EnglishSynonyms: | RARECHEM AL BW 0763 |
| pro_mdlNumber: | MFCD06212848 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | c1ccc2c(c1)cccc2C(CN)CN |
| InChi: | InChI=1S/C13H16N2/c14-8-11(9-15)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11H,8-9,14-15H2 |
| InChiKey: | InChIKey=ROYPNZQRQUNVHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.