* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BW 0774 |
EnglishSynonyms: | RARECHEM AL BW 0774 |
pro_mdlNumber: | MFCD06212853 |
pro_acceptors: | 1 |
pro_donors: | 1 |
pro_smile: | CCCCCCCc1ccc(cc1)CN |
InChi: | InChI=1S/C14H23N/c1-2-3-4-5-6-7-13-8-10-14(12-15)11-9-13/h8-11H,2-7,12,15H2,1H3 |
InChiKey: | InChIKey=FKXBOOWRGQOYSJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.