* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 0895 |
| EnglishSynonyms: | RARECHEM AL BW 0895 |
| pro_mdlNumber: | MFCD06212932 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CC(C)[Si](CCCCN)(C(C)C)N(C)C |
| InChi: | InChI=1S/C12H30N2Si/c1-11(2)15(12(3)4,14(5)6)10-8-7-9-13/h11-12H,7-10,13H2,1-6H3 |
| InChiKey: | InChIKey=UWSZWIAVOKOTFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.