* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 1602 |
| EnglishSynonyms: | RARECHEM AL BW 1602 |
| pro_mdlNumber: | MFCD06213377 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | C(C(C(C(C(C(C(C(F)(F)Br)(F)Br)(F)F)(F)Br)(F)F)(F)Br)(F)F)N |
| InChi: | InChI=1S/C8H4Br4F11N/c9-3(15,2(13,14)1-24)6(18,19)4(10,16)7(20,21)5(11,17)8(12,22)23/h1,24H2 |
| InChiKey: | InChIKey=IBGJXWILMZNIFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.