* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 1621 |
| EnglishSynonyms: | RARECHEM AL BW 1621 |
| pro_mdlNumber: | MFCD06213392 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)c1cc(c(nc1C)S)CN |
| InChi: | InChI=1S/C10H14N2O2S/c1-3-14-10(13)8-4-7(5-11)9(15)12-6(8)2/h4H,3,5,11H2,1-2H3,(H,12,15) |
| InChiKey: | InChIKey=ODPGSIYYLUVSCT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.