* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 1625 |
| EnglishSynonyms: | RARECHEM AL BW 1625 |
| pro_mdlNumber: | MFCD06213395 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CSc1c(c(n(n1)c2ccccc2)N)CN |
| InChi: | InChI=1S/C11H14N4S/c1-16-11-9(7-12)10(13)15(14-11)8-5-3-2-4-6-8/h2-6H,7,12-13H2,1H3 |
| InChiKey: | InChIKey=QZICKVQNSBBYSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.