* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BW 1647 |
EnglishSynonyms: | RARECHEM AL BW 1647 |
pro_mdlNumber: | MFCD06213409 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | Cc1ccc(cc1)S(=O)(=O)[O-].c1ccc2c[n+](c(cc2c1)CN)N |
InChi: | InChI=1S/C10H12N3.C7H8O3S/c11-6-10-5-8-3-1-2-4-9(8)7-13(10)12;1-6-2-4-7(5-3-6)11(8,9)10/h1-5,7H,6,11-12H2;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
InChiKey: | InChIKey=OSEFXHPCMJISRM-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.