* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BW 1701 |
EnglishSynonyms: | RARECHEM AL BW 1701 |
pro_mdlNumber: | MFCD06213439 |
pro_acceptors: | 2 |
pro_donors: | 2 |
pro_smile: | c1ccc(cc1)C(CN)c2ccccc2CN |
InChi: | InChI=1S/C15H18N2/c16-10-13-8-4-5-9-14(13)15(11-17)12-6-2-1-3-7-12/h1-9,15H,10-11,16-17H2 |
InChiKey: | InChIKey=YVNXGCSRIFOJRZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.