* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 1939 |
| EnglishSynonyms: | RARECHEM AL BW 1939 |
| pro_mdlNumber: | MFCD06213559 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | Cc1csc(c1CN)NC(=O)OCCCl |
| InChi: | InChI=1S/C9H13ClN2O2S/c1-6-5-15-8(7(6)4-11)12-9(13)14-3-2-10/h5H,2-4,11H2,1H3,(H,12,13) |
| InChiKey: | InChIKey=FOGFSFWNTYJMKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.