* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 1985 |
| EnglishSynonyms: | RARECHEM AL BW 1985 |
| pro_mdlNumber: | MFCD06213589 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | c1cc(c(c(c1)[Zn]I)CN)F |
| InChi: | InChI=1S/C7H7FN.HI.Zn/c8-7-4-2-1-3-6(7)5-9;;/h1-2,4H,5,9H2;1H;/q;;+1/p-1 |
| InChiKey: | InChIKey=JAEPSQDYYJWALE-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.