* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 2013 |
| EnglishSynonyms: | RARECHEM AL BW 2013 |
| pro_mdlNumber: | MFCD06213601 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | c1cc(c(c(c1OCC(F)(F)F)CN)OCC(F)(F)F)S(=O)(=O)Cl |
| InChi: | InChI=1S/C11H10ClF6NO4S/c12-24(20,21)8-2-1-7(22-4-10(13,14)15)6(3-19)9(8)23-5-11(16,17)18/h1-2H,3-5,19H2 |
| InChiKey: | InChIKey=VJOBROXVPOKZKF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.