* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BW 2162 |
| EnglishSynonyms: | RARECHEM AL BW 2162 |
| pro_mdlNumber: | MFCD06213689 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | COC(=O)C(Cc1ccccc1Cl)CN |
| InChi: | InChI=1S/C11H14ClNO2/c1-15-11(14)9(7-13)6-8-4-2-3-5-10(8)12/h2-5,9H,6-7,13H2,1H3 |
| InChiKey: | InChIKey=PUGDXBSDCSVWJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.