* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0190 |
| EnglishSynonyms: | RARECHEM AL BZ 0190 |
| pro_mdlNumber: | MFCD06216315 |
| pro_acceptors: | 7 |
| pro_donors: | 3 |
| pro_smile: | c1cc(c(cc1[N+](=O)[O-])C(CC(=O)N)N)O |
| InChi: | InChI=1S/C9H11N3O4/c10-7(4-9(11)14)6-3-5(12(15)16)1-2-8(6)13/h1-3,7,13H,4,10H2,(H2,11,14) |
| InChiKey: | InChIKey=ZVUGKCXZVGZILM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.