* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BZ 0219 |
EnglishSynonyms: | RARECHEM AL BZ 0219 |
pro_mdlNumber: | MFCD06216343 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | CCCCCCCCC/C=C/C(CC(=O)N)N |
InChi: | InChI=1S/C14H28N2O/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14(16)17/h10-11,13H,2-9,12,15H2,1H3,(H2,16,17)/b11-10+ |
InChiKey: | InChIKey=ZQVCICJSCSXPIM-ZHACJKMWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.