* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BZ 0231 |
EnglishSynonyms: | RARECHEM AL BZ 0231 |
pro_mdlNumber: | MFCD06216355 |
pro_acceptors: | 4 |
pro_donors: | 2 |
pro_smile: | C=CCOc1ccccc1C(CC(=O)N)N |
InChi: | InChI=1S/C12H16N2O2/c1-2-7-16-11-6-4-3-5-9(11)10(13)8-12(14)15/h2-6,10H,1,7-8,13H2,(H2,14,15) |
InChiKey: | InChIKey=APWVVLCLAYXWBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.