* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0241 |
| EnglishSynonyms: | RARECHEM AL BZ 0241 |
| pro_mdlNumber: | MFCD06216365 |
| pro_acceptors: | 7 |
| pro_donors: | 5 |
| pro_smile: | Cc1cc(c(c(c1)C(CC(=O)N)N)O)C(CC(=O)N)N |
| InChi: | InChI=1S/C13H20N4O3/c1-6-2-7(9(14)4-11(16)18)13(20)8(3-6)10(15)5-12(17)19/h2-3,9-10,20H,4-5,14-15H2,1H3,(H2,16,18)(H2,17,19) |
| InChiKey: | InChIKey=AOEVCFAIZCPCNX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.