* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0246 |
| EnglishSynonyms: | RARECHEM AL BZ 0246 |
| pro_mdlNumber: | MFCD06216370 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | CCOc1ccc(cc1OCC)C(CC(=O)N)N |
| InChi: | InChI=1S/C13H20N2O3/c1-3-17-11-6-5-9(7-12(11)18-4-2)10(14)8-13(15)16/h5-7,10H,3-4,8,14H2,1-2H3,(H2,15,16) |
| InChiKey: | InChIKey=MHLVPJKCYOXBOL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.