* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BZ 0253 |
EnglishSynonyms: | RARECHEM AL BZ 0253 |
pro_mdlNumber: | MFCD06216377 |
pro_acceptors: | 6 |
pro_donors: | 4 |
pro_smile: | c1ccc2cc(c(cc2c1)C(CC(=O)N)N)C(CC(=O)N)N |
InChi: | InChI=1S/C16H20N4O2/c17-13(7-15(19)21)11-5-9-3-1-2-4-10(9)6-12(11)14(18)8-16(20)22/h1-6,13-14H,7-8,17-18H2,(H2,19,21)(H2,20,22) |
InChiKey: | InChIKey=RLDZZACSTXXJOL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.