* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0259 |
| EnglishSynonyms: | RARECHEM AL BZ 0259 |
| pro_mdlNumber: | MFCD06216383 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CC(C)c1ccc(cc1)CC(C)C(CC(=O)N)N |
| InChi: | InChI=1S/C15H24N2O/c1-10(2)13-6-4-12(5-7-13)8-11(3)14(16)9-15(17)18/h4-7,10-11,14H,8-9,16H2,1-3H3,(H2,17,18) |
| InChiKey: | InChIKey=KPDPMOMENQNQHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.