* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0379 |
| EnglishSynonyms: | RARECHEM AL BZ 0379 |
| pro_mdlNumber: | MFCD06216490 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | COc1cc(ccc1F)C(CC(=O)N)N |
| InChi: | InChI=1S/C10H13FN2O2/c1-15-9-4-6(2-3-7(9)11)8(12)5-10(13)14/h2-4,8H,5,12H2,1H3,(H2,13,14) |
| InChiKey: | InChIKey=RURYEEHMMJGVAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.