* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0410 |
| EnglishSynonyms: | RARECHEM AL BZ 0410 |
| pro_mdlNumber: | MFCD06216508 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)N)C(=O)N |
| InChi: | InChI=1S/C7H8F8N2O/c8-4(9)6(12,13)7(14,15)5(10,11)2(16)1-3(17)18/h2,4H,1,16H2,(H2,17,18) |
| InChiKey: | InChIKey=INAQJIOZHUQYLM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.