* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0411 |
| EnglishSynonyms: | RARECHEM AL BZ 0411 |
| pro_mdlNumber: | MFCD06216509 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | C(C(CC(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)N)C(=O)N |
| InChi: | InChI=1S/C9H9F11N2O2/c10-5(7(13,14)15,2-3(21)1-4(22)23)24-9(19,20)6(11,12)8(16,17)18/h3H,1-2,21H2,(H2,22,23) |
| InChiKey: | InChIKey=UBKSCVHLNBDHNG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.