* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0415 |
| EnglishSynonyms: | RARECHEM AL BZ 0415 |
| pro_mdlNumber: | MFCD06216512 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | C(C(CC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)N)C(=O)N |
| InChi: | InChI=1S/C10H9F13N2O/c11-5(12,2-3(24)1-4(25)26)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h3H,1-2,24H2,(H2,25,26) |
| InChiKey: | InChIKey=ACCAHENLKUQYSO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.