* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 0420 |
| EnglishSynonyms: | RARECHEM AL BZ 0420 |
| pro_mdlNumber: | MFCD06216517 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | c1cc(cc(c1)OCCO)C(CC(=O)N)N |
| InChi: | InChI=1S/C11H16N2O3/c12-10(7-11(13)15)8-2-1-3-9(6-8)16-5-4-14/h1-3,6,10,14H,4-5,7,12H2,(H2,13,15) |
| InChiKey: | InChIKey=GKMWWODTBUYUNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.