* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1093 |
| EnglishSynonyms: | RARECHEM AL BZ 1093 |
| pro_mdlNumber: | MFCD06217106 |
| pro_acceptors: | 9 |
| pro_donors: | 3 |
| pro_smile: | CS(=O)(=O)c1ccc(c(c1)[N+](=O)[O-])/C(=C/O)/C(CC(=O)N)N |
| InChi: | InChI=1S/C12H15N3O6S/c1-22(20,21)7-2-3-8(11(4-7)15(18)19)9(6-16)10(13)5-12(14)17/h2-4,6,10,16H,5,13H2,1H3,(H2,14,17)/b9-6- |
| InChiKey: | InChIKey=ZRZYNOPBVGPWTI-TWGQIWQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.