* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BZ 1109 |
EnglishSynonyms: | RARECHEM AL BZ 1109 |
pro_mdlNumber: | MFCD06217120 |
pro_acceptors: | 7 |
pro_donors: | 3 |
pro_smile: | COc1ccc(cc1)N/N=C(\C(CC(=O)N)N)/C(=O)c2cccs2 |
InChi: | InChI=1S/C16H18N4O3S/c1-23-11-6-4-10(5-7-11)19-20-15(12(17)9-14(18)21)16(22)13-3-2-8-24-13/h2-8,12,19H,9,17H2,1H3,(H2,18,21)/b20-15+ |
InChiKey: | InChIKey=PKWWOHONXFSBIO-HMMYKYKNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.