* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1127 |
| EnglishSynonyms: | RARECHEM AL BZ 1127 |
| pro_mdlNumber: | MFCD06217137 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(cc1)S(=O)(=O)/C(=C/c2ccc(cc2)C(CC(=O)N)N)/C#N |
| InChi: | InChI=1S/C18H17N3O3S/c19-12-16(25(23,24)15-4-2-1-3-5-15)10-13-6-8-14(9-7-13)17(20)11-18(21)22/h1-10,17H,11,20H2,(H2,21,22)/b16-10+ |
| InChiKey: | InChIKey=XHKUOEQXMXFEDO-MHWRWJLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.