* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1141 |
| EnglishSynonyms: | RARECHEM AL BZ 1141 |
| pro_mdlNumber: | MFCD06217151 |
| pro_acceptors: | 7 |
| pro_donors: | 4 |
| pro_smile: | COc1ccc(cc1C(CC(=O)N)N)C(CC(=O)N)N |
| InChi: | InChI=1S/C13H20N4O3/c1-20-11-3-2-7(9(14)5-12(16)18)4-8(11)10(15)6-13(17)19/h2-4,9-10H,5-6,14-15H2,1H3,(H2,16,18)(H2,17,19) |
| InChiKey: | InChIKey=UQVZRHLRGIVPQP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.