* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1143 |
| EnglishSynonyms: | RARECHEM AL BZ 1143 |
| pro_mdlNumber: | MFCD06217153 |
| pro_acceptors: | 7 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(cc1)Cn2cc(c3c2ccc(c3)[N+](=O)[O-])C(CC(=O)N)N |
| InChi: | InChI=1S/C18H18N4O3/c19-16(9-18(20)23)15-11-21(10-12-4-2-1-3-5-12)17-7-6-13(22(24)25)8-14(15)17/h1-8,11,16H,9-10,19H2,(H2,20,23) |
| InChiKey: | InChIKey=ABXMCQWQRYNOLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.