* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BZ 1158 |
EnglishSynonyms: | RARECHEM AL BZ 1158 |
pro_mdlNumber: | MFCD06217167 |
pro_acceptors: | 4 |
pro_donors: | 2 |
pro_smile: | c1ccc2c(c1)c(cn2Cc3cc(cc(c3)F)F)C(CC(=O)N)N |
InChi: | InChI=1S/C18H17F2N3O/c19-12-5-11(6-13(20)7-12)9-23-10-15(16(21)8-18(22)24)14-3-1-2-4-17(14)23/h1-7,10,16H,8-9,21H2,(H2,22,24) |
InChiKey: | InChIKey=TWUFFUJEUODPLH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.