* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1187 |
| EnglishSynonyms: | RARECHEM AL BZ 1187 |
| pro_mdlNumber: | MFCD06217194 |
| pro_acceptors: | 7 |
| pro_donors: | 2 |
| pro_smile: | c1ccc2c(c1)C(=O)N(C2=O)CCCOc3ccc(cc3)C(CC(=O)N)N |
| InChi: | InChI=1S/C20H21N3O4/c21-17(12-18(22)24)13-6-8-14(9-7-13)27-11-3-10-23-19(25)15-4-1-2-5-16(15)20(23)26/h1-2,4-9,17H,3,10-12,21H2,(H2,22,24) |
| InChiKey: | InChIKey=BPKGXPRFHVKQBK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.