* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1188 |
| EnglishSynonyms: | RARECHEM AL BZ 1188 |
| pro_mdlNumber: | MFCD06217195 |
| pro_acceptors: | 7 |
| pro_donors: | 3 |
| pro_smile: | CCOC(=O)c1cc(oc1N)/C=C/C(CC(=O)N)N |
| InChi: | InChI=1S/C12H17N3O4/c1-2-18-12(17)9-6-8(19-11(9)15)4-3-7(13)5-10(14)16/h3-4,6-7H,2,5,13,15H2,1H3,(H2,14,16)/b4-3+ |
| InChiKey: | InChIKey=XJYYJZCQFXGKGX-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.