* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BZ 1194 |
EnglishSynonyms: | RARECHEM AL BZ 1194 |
pro_mdlNumber: | MFCD06217201 |
pro_acceptors: | 6 |
pro_donors: | 2 |
pro_smile: | COc1cc(ccc1OC(=O)c2ccc(c(c2)Cl)Cl)C(CC(=O)N)N |
InChi: | InChI=1S/C17H16Cl2N2O4/c1-24-15-7-9(13(20)8-16(21)22)3-5-14(15)25-17(23)10-2-4-11(18)12(19)6-10/h2-7,13H,8,20H2,1H3,(H2,21,22) |
InChiKey: | InChIKey=VVVHRSHRPQPNDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.