* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BZ 1264 |
EnglishSynonyms: | RARECHEM AL BZ 1264 |
pro_mdlNumber: | MFCD06217269 |
pro_acceptors: | 5 |
pro_donors: | 2 |
pro_smile: | Cn1c(c(c(n1)C(F)(F)F)C(CC(=O)N)N)Sc2cccc(c2)C(F)(F)F |
InChi: | InChI=1S/C15H14F6N4OS/c1-25-13(27-8-4-2-3-7(5-8)14(16,17)18)11(9(22)6-10(23)26)12(24-25)15(19,20)21/h2-5,9H,6,22H2,1H3,(H2,23,26) |
InChiKey: | InChIKey=BZDFZBDXAPZGCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.