* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1273 |
| EnglishSynonyms: | RARECHEM AL BZ 1273 |
| pro_mdlNumber: | MFCD06217278 |
| pro_acceptors: | 6 |
| pro_donors: | 3 |
| pro_smile: | CC(C)(C)C(=O)Nc1ccncc1C(CC(=O)N)N |
| InChi: | InChI=1S/C13H20N4O2/c1-13(2,3)12(19)17-10-4-5-16-7-8(10)9(14)6-11(15)18/h4-5,7,9H,6,14H2,1-3H3,(H2,15,18)(H,16,17,19) |
| InChiKey: | InChIKey=WMRYAKDMZWYKEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.