* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1310 |
| EnglishSynonyms: | RARECHEM AL BZ 1310 |
| pro_mdlNumber: | MFCD06217315 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | c1cc(ccc1c2ccc(cc2)C(=O)N)C(CC(=O)N)N |
| InChi: | InChI=1S/C16H17N3O2/c17-14(9-15(18)20)12-5-1-10(2-6-12)11-3-7-13(8-4-11)16(19)21/h1-8,14H,9,17H2,(H2,18,20)(H2,19,21) |
| InChiKey: | InChIKey=QOWLKTLUNZHKMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.