* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1340 |
| EnglishSynonyms: | RARECHEM AL BZ 1340 |
| pro_mdlNumber: | MFCD06217342 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | c1cc(cc(c1)C(F)(F)F)c2ccc(cc2)C(CC(=O)N)N |
| InChi: | InChI=1S/C16H15F3N2O/c17-16(18,19)13-3-1-2-12(8-13)10-4-6-11(7-5-10)14(20)9-15(21)22/h1-8,14H,9,20H2,(H2,21,22) |
| InChiKey: | InChIKey=GSWMGFWWNZCPCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.