* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1344 |
| EnglishSynonyms: | RARECHEM AL BZ 1344 |
| pro_mdlNumber: | MFCD06217346 |
| pro_acceptors: | 6 |
| pro_donors: | 4 |
| pro_smile: | c1cc(cc(c1)Br)C(C(CC(=O)N)N)C(CC(=O)N)N |
| InChi: | InChI=1S/C13H19BrN4O2/c14-8-3-1-2-7(4-8)13(9(15)5-11(17)19)10(16)6-12(18)20/h1-4,9-10,13H,5-6,15-16H2,(H2,17,19)(H2,18,20) |
| InChiKey: | InChIKey=GYMSWKKFRHFHQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.