* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BZ 1443 |
| EnglishSynonyms: | RARECHEM AL BZ 1443 |
| pro_mdlNumber: | MFCD06217426 |
| pro_acceptors: | 6 |
| pro_donors: | 3 |
| pro_smile: | c1ccc(cc1)C(c2ccccc2)(c3ccccc3)n4cc(nc4)C[C@@H](C(CC(=O)N)N)N |
| InChi: | InChI=1S/C27H29N5O/c28-24(25(29)17-26(30)33)16-23-18-32(19-31-23)27(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,18-19,24-25H,16-17,28-29H2,(H2,30,33)/t24-,25?/m0/s1 |
| InChiKey: | InChIKey=DKRPYYRRVGOUQP-SKCDSABHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.