* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AM LA 0007 |
| EnglishSynonyms: | RARECHEM AM LA 0007 |
| pro_mdlNumber: | MFCD06227441 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | c1ccc2c(c1)OC(=S2)C=O |
| InChi: | InChI=1S/C8H5O2S/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-5H |
| InChiKey: | InChIKey=BPOGZRVXQUCAQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.