* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ A1 0051 |
| EnglishSynonyms: | RARECHEM AQ A1 0051 |
| pro_mdlNumber: | MFCD06227536 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CC(C)NO.CC(C)NO.OS(=O)(=O)O |
| InChi: | InChI=1S/2C3H9NO.H2O4S/c2*1-3(2)4-5;1-5(2,3)4/h2*3-5H,1-2H3;(H2,1,2,3,4) |
| InChiKey: | InChIKey=CSLYMPDYAQYLBZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.